C10H14N4O3S — CID 55091658
2-[5-amino-2-(hydroxymethyl)benzimidazol-1-yl]ethanesulfonamide (PubChem CID 55091658) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-[5-amino-2-(hydroxymethyl)benzimidazol-1-yl]ethanesulfonamide.
| Compound Name | 2-[5-amino-2-(hydroxymethyl)benzimidazol-1-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 55091658 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[5-amino-2-(hydroxymethyl)benzimidazol-1-yl]ethanesulfonamide |
| SMILES | Nc1ccc2c(c1)nc(CO)n2CCS(N)(=O)=O |
| InChI | InChI=1S/C10H14N4O3S/c11-7-1-2-9-8(5-7)13-10(6-15)14(9)3-4-18(12,16)17/h1-2,5,15H,3-4,6,11H2,(H2,12,16,17) |
| InChIKey | TUJOIUGYLSOQRA-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|