C12H12N4O2 — CID 81174050
[5-amino-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-yl]methanol (PubChem CID 81174050) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is [5-amino-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-yl]methanol.
| Compound Name | [5-amino-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-yl]methanol |
|---|---|
| PubChem CID | 81174050 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | [5-amino-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-yl]methanol |
| SMILES | Nc1ccc2c(c1)nc(CO)n2Cc1ccon1 |
| InChI | InChI=1S/C12H12N4O2/c13-8-1-2-11-10(5-8)14-12(7-17)16(11)6-9-3-4-18-15-9/h1-5,17H,6-7,13H2 |
| InChIKey | VYJYKMINLKRBEP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|