C12H8Cl3N3O — CID 81176745
3-[[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]methyl]-1,2-oxazole (PubChem CID 81176745) has the molecular formula C12H8Cl3N3O and a molecular weight of 316.58 g/mol. Its IUPAC name is 3-[[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]methyl]-1,2-oxazole.
| Compound Name | 3-[[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 81176745 |
| Molecular Formula | C12H8Cl3N3O |
| Molecular Weight | 316.58 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 3-[[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]methyl]-1,2-oxazole |
| SMILES | ClCc1nc2cc(Cl)c(Cl)cc2n1Cc1ccon1 |
| InChI | InChI=1S/C12H8Cl3N3O/c13-5-12-16-10-3-8(14)9(15)4-11(10)18(12)6-7-1-2-19-17-7/h1-4H,5-6H2 |
| InChIKey | IXDOCEBGHYOOQF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|