C12H8Cl2FN3S — CID 66112596
4-[[5-chloro-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]-1,3-thiazole (PubChem CID 66112596) has the molecular formula C12H8Cl2FN3S and a molecular weight of 316.19 g/mol. Its IUPAC name is 4-[[5-chloro-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]-1,3-thiazole.
| Compound Name | 4-[[5-chloro-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 66112596 |
| Molecular Formula | C12H8Cl2FN3S |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 4-[[5-chloro-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]-1,3-thiazole |
| SMILES | Fc1cc2c(cc1Cl)nc(CCl)n2Cc1cscn1 |
| InChI | InChI=1S/C12H8Cl2FN3S/c13-3-12-17-10-1-8(14)9(15)2-11(10)18(12)4-7-5-19-6-16-7/h1-2,5-6H,3-4H2 |
| InChIKey | RARCAROGWUGTCB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|