C12H9ClIN3O — CID 81177416
3-[[2-(chloromethyl)-5-iodobenzimidazol-1-yl]methyl]-1,2-oxazole (PubChem CID 81177416) has the molecular formula C12H9ClIN3O and a molecular weight of 373.58 g/mol. Its IUPAC name is 3-[[2-(chloromethyl)-5-iodobenzimidazol-1-yl]methyl]-1,2-oxazole.
| Compound Name | 3-[[2-(chloromethyl)-5-iodobenzimidazol-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 81177416 |
| Molecular Formula | C12H9ClIN3O |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | 3-[[2-(chloromethyl)-5-iodobenzimidazol-1-yl]methyl]-1,2-oxazole |
| SMILES | ClCc1nc2cc(I)ccc2n1Cc1ccon1 |
| InChI | InChI=1S/C12H9ClIN3O/c13-6-12-15-10-5-8(14)1-2-11(10)17(12)7-9-3-4-18-16-9/h1-5H,6-7H2 |
| InChIKey | GEJJRTHJABMTKZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|