C16H17BrFN — CID 55095249
2-(4-bromo-2-fluorophenyl)-N-methyl-1-(4-methylphenyl)ethanamine (PubChem CID 55095249) has the molecular formula C16H17BrFN and a molecular weight of 322.22 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-N-methyl-1-(4-methylphenyl)ethanamine.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-N-methyl-1-(4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 55095249 |
| Molecular Formula | C16H17BrFN |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-N-methyl-1-(4-methylphenyl)ethanamine |
| SMILES | CNC(Cc1ccc(Br)cc1F)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H17BrFN/c1-11-3-5-12(6-4-11)16(19-2)9-13-7-8-14(17)10-15(13)18/h3-8,10,16,19H,9H2,1-2H3 |
| InChIKey | DDIVBCWTIQGSIU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |