C13H13BrFN3 — CID 62600239
2-(4-bromo-2-fluorophenyl)-N-methyl-1-pyrimidin-2-ylethanamine (PubChem CID 62600239) has the molecular formula C13H13BrFN3 and a molecular weight of 310.17 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-N-methyl-1-pyrimidin-2-ylethanamine.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-N-methyl-1-pyrimidin-2-ylethanamine |
|---|---|
| PubChem CID | 62600239 |
| Molecular Formula | C13H13BrFN3 |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-N-methyl-1-pyrimidin-2-ylethanamine |
| SMILES | CNC(Cc1ccc(Br)cc1F)c1ncccn1 |
| InChI | InChI=1S/C13H13BrFN3/c1-16-12(13-17-5-2-6-18-13)7-9-3-4-10(14)8-11(9)15/h2-6,8,12,16H,7H2,1H3 |
| InChIKey | OXSAJGXOECUIKM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |