C16H16BrFO — CID 55095424
1-(5-bromo-2-fluorophenyl)-4-phenylbutan-2-ol (PubChem CID 55095424) has the molecular formula C16H16BrFO and a molecular weight of 323.20 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-4-phenylbutan-2-ol.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 55095424 |
| Molecular Formula | C16H16BrFO |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-4-phenylbutan-2-ol |
| SMILES | OC(CCc1ccccc1)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C16H16BrFO/c17-14-7-9-16(18)13(10-14)11-15(19)8-6-12-4-2-1-3-5-12/h1-5,7,9-10,15,19H,6,8,11H2 |
| InChIKey | APOZALGKTFAXLU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |