C16H15Br2FO — CID 66037391
2-[(5-bromo-2-fluorophenyl)methyl]-3-(2-bromophenyl)propan-1-ol (PubChem CID 66037391) has the molecular formula C16H15Br2FO and a molecular weight of 402.10 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl]-3-(2-bromophenyl)propan-1-ol.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl]-3-(2-bromophenyl)propan-1-ol |
|---|---|
| PubChem CID | 66037391 |
| Molecular Formula | C16H15Br2FO |
| Molecular Weight | 402.10 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl]-3-(2-bromophenyl)propan-1-ol |
| SMILES | OCC(Cc1cc(Br)ccc1F)Cc1ccccc1Br |
| InChI | InChI=1S/C16H15Br2FO/c17-14-5-6-16(19)13(9-14)8-11(10-20)7-12-3-1-2-4-15(12)18/h1-6,9,11,20H,7-8,10H2 |
| InChIKey | UJUSHWAXSJIEEP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.10 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |