C13H18BrFO — CID 66059383
2-[(5-bromo-2-fluorophenyl)methyl]-4-methylpentan-1-ol (PubChem CID 66059383) has the molecular formula C13H18BrFO and a molecular weight of 289.19 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl]-4-methylpentan-1-ol.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 66059383 |
| Molecular Formula | C13H18BrFO |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl]-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H18BrFO/c1-9(2)5-10(8-16)6-11-7-12(14)3-4-13(11)15/h3-4,7,9-10,16H,5-6,8H2,1-2H3 |
| InChIKey | ZYVYDAHLSAWLIC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |