C13H13FN2O2 — CID 55096330
2-(3-fluoro-4-methoxyphenyl)-1-pyrazin-2-ylethanol (PubChem CID 55096330) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-1-pyrazin-2-ylethanol.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-1-pyrazin-2-ylethanol |
|---|---|
| PubChem CID | 55096330 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-1-pyrazin-2-ylethanol |
| SMILES | COc1ccc(CC(O)c2cnccn2)cc1F |
| InChI | InChI=1S/C13H13FN2O2/c1-18-13-3-2-9(6-10(13)14)7-12(17)11-8-15-4-5-16-11/h2-6,8,12,17H,7H2,1H3 |
| InChIKey | XVZNUJDPQXGFCA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |