C13H13F2NO — CID 55097732
1-[5-(2,3-difluorophenyl)furan-2-yl]propan-1-amine (PubChem CID 55097732) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is 1-[5-(2,3-difluorophenyl)furan-2-yl]propan-1-amine.
| Compound Name | 1-[5-(2,3-difluorophenyl)furan-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 55097732 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-[5-(2,3-difluorophenyl)furan-2-yl]propan-1-amine |
| SMILES | CCC(N)c1ccc(-c2cccc(F)c2F)o1 |
| InChI | InChI=1S/C13H13F2NO/c1-2-10(16)12-7-6-11(17-12)8-4-3-5-9(14)13(8)15/h3-7,10H,2,16H2,1H3 |
| InChIKey | NGZCFWUGGUCSPZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |