C16H28N2 — CID 55098115
1-(2-methylphenyl)-N',N'-dipropylpropane-1,3-diamine (PubChem CID 55098115) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N',N'-dipropylpropane-1,3-diamine.
| Compound Name | 1-(2-methylphenyl)-N',N'-dipropylpropane-1,3-diamine |
|---|---|
| PubChem CID | 55098115 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-(2-methylphenyl)-N',N'-dipropylpropane-1,3-diamine |
| SMILES | CCCN(CCC)CCC(N)c1ccccc1C |
| InChI | InChI=1S/C16H28N2/c1-4-11-18(12-5-2)13-10-16(17)15-9-7-6-8-14(15)3/h6-9,16H,4-5,10-13,17H2,1-3H3 |
| InChIKey | QTINEYGAQHWXAM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |