About N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine
N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine (PubChem CID 62623076) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine |
| PubChem CID | 62623076 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine |
| SMILES | CCN(CCC(N)c1ccccc1C)Cc1ccco1 |
| InChI | InChI=1S/C17H24N2O/c1-3-19(13-15-8-6-12-20-15)11-10-17(18)16-9-5-4-7-14(16)2/h4-9,12,17H,3,10-11,13,18H2,1-2H3 |
| InChIKey | ALFJRNOVUMSEOA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine?
The IUPAC name of N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine (CID 62623076) is N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine.
What is the SMILES notation for N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine?
The canonical SMILES for N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine is CCN(CCC(N)c1ccccc1C)Cc1ccco1.
What is the InChIKey of N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine?
The InChIKey is ALFJRNOVUMSEOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-3-19(13-15-8-6-12-20-15)11-10-17(18)16-9-5-4-7-14(16)2/h4-9,12,17H,3,10-11,13,18H2,1-2H3.
What are the key properties of N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine?
N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine has a molecular weight of 272.39 g/mol, XLogP of 3.50, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-(furan-2-ylmethyl)-1-(2-methylphenyl)propane-1,3-diamine is sourced from PubChem (CID 62623076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).