C14H20F2N2S — CID 55100178
2-(difluoromethylsulfanyl)-N-[(1-methylpiperidin-2-yl)methyl]aniline (PubChem CID 55100178) has the molecular formula C14H20F2N2S and a molecular weight of 286.39 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[(1-methylpiperidin-2-yl)methyl]aniline.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[(1-methylpiperidin-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 55100178 |
| Molecular Formula | C14H20F2N2S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[(1-methylpiperidin-2-yl)methyl]aniline |
| SMILES | CN1CCCCC1CNc1ccccc1SC(F)F |
| InChI | InChI=1S/C14H20F2N2S/c1-18-9-5-4-6-11(18)10-17-12-7-2-3-8-13(12)19-14(15)16/h2-3,7-8,11,14,17H,4-6,9-10H2,1H3 |
| InChIKey | BYTJQENWSCKGNB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |