C13H18N4Se — CID 62658263
N-[(1-methylpiperidin-2-yl)methyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 62658263) has the molecular formula C13H18N4Se and a molecular weight of 309.27 g/mol. Its IUPAC name is N-[(1-methylpiperidin-2-yl)methyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[(1-methylpiperidin-2-yl)methyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 62658263 |
| Molecular Formula | C13H18N4Se |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-[(1-methylpiperidin-2-yl)methyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CN1CCCCC1CNc1cccc2n[se]nc12 |
| InChI | InChI=1S/C13H18N4Se/c1-17-8-3-2-5-10(17)9-14-11-6-4-7-12-13(11)16-18-15-12/h4,6-7,10,14H,2-3,5,8-9H2,1H3 |
| InChIKey | ZDBRCSJTSHHFMX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|