C9H5Cl3N4O2 — CID 55103950
4-amino-N-(2,4,5-trichlorophenyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 55103950) has the molecular formula C9H5Cl3N4O2 and a molecular weight of 307.52 g/mol. Its IUPAC name is 4-amino-N-(2,4,5-trichlorophenyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-(2,4,5-trichlorophenyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 55103950 |
| Molecular Formula | C9H5Cl3N4O2 |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 4-amino-N-(2,4,5-trichlorophenyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H5Cl3N4O2/c10-3-1-5(12)6(2-4(3)11)14-9(17)7-8(13)16-18-15-7/h1-2H,(H2,13,16)(H,14,17) |
| InChIKey | DWTXRMFUVXVQGI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|