C11H9Cl3N4O — CID 62081034
4-amino-5-methyl-N-(2,4,5-trichlorophenyl)-1H-pyrazole-3-carboxamide (PubChem CID 62081034) has the molecular formula C11H9Cl3N4O and a molecular weight of 319.58 g/mol. Its IUPAC name is 4-amino-5-methyl-N-(2,4,5-trichlorophenyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-5-methyl-N-(2,4,5-trichlorophenyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 62081034 |
| Molecular Formula | C11H9Cl3N4O |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 4-amino-5-methyl-N-(2,4,5-trichlorophenyl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C11H9Cl3N4O/c1-4-9(15)10(18-17-4)11(19)16-8-3-6(13)5(12)2-7(8)14/h2-3H,15H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | HCXOKJPIERKYMZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|