C11H9BrF2N4O — CID 107608683
4-amino-N-(4-bromo-2,5-difluorophenyl)-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 107608683) has the molecular formula C11H9BrF2N4O and a molecular weight of 331.12 g/mol. Its IUPAC name is 4-amino-N-(4-bromo-2,5-difluorophenyl)-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N-(4-bromo-2,5-difluorophenyl)-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107608683 |
| Molecular Formula | C11H9BrF2N4O |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 4-amino-N-(4-bromo-2,5-difluorophenyl)-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)Nc2cc(F)c(Br)cc2F)c1N |
| InChI | InChI=1S/C11H9BrF2N4O/c1-4-9(15)10(18-17-4)11(19)16-8-3-6(13)5(12)2-7(8)14/h2-3H,15H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | GNDZRKMANJQZLT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|