C15H27NS — CID 55106895
2-ethyl-N-(2-methylpropyl)-2-(thiophen-3-ylmethyl)butan-1-amine (PubChem CID 55106895) has the molecular formula C15H27NS and a molecular weight of 253.46 g/mol. Its IUPAC name is 2-ethyl-N-(2-methylpropyl)-2-(thiophen-3-ylmethyl)butan-1-amine.
| Compound Name | 2-ethyl-N-(2-methylpropyl)-2-(thiophen-3-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 55106895 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.46 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 2-ethyl-N-(2-methylpropyl)-2-(thiophen-3-ylmethyl)butan-1-amine |
| SMILES | CCC(CC)(CNCC(C)C)Cc1ccsc1 |
| InChI | InChI=1S/C15H27NS/c1-5-15(6-2,12-16-10-13(3)4)9-14-7-8-17-11-14/h7-8,11,13,16H,5-6,9-10,12H2,1-4H3 |
| InChIKey | CWGQVIDRBJATQW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |