C12H18Br2S — CID 79453120
3-[2,2-bis(bromomethyl)-4-methylpentyl]thiophene (PubChem CID 79453120) has the molecular formula C12H18Br2S and a molecular weight of 354.15 g/mol. Its IUPAC name is 3-[2,2-bis(bromomethyl)-4-methylpentyl]thiophene.
| Compound Name | 3-[2,2-bis(bromomethyl)-4-methylpentyl]thiophene |
|---|---|
| PubChem CID | 79453120 |
| Molecular Formula | C12H18Br2S |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | 3-[2,2-bis(bromomethyl)-4-methylpentyl]thiophene |
| SMILES | CC(C)CC(CBr)(CBr)Cc1ccsc1 |
| InChI | InChI=1S/C12H18Br2S/c1-10(2)5-12(8-13,9-14)6-11-3-4-15-7-11/h3-4,7,10H,5-6,8-9H2,1-2H3 |
| InChIKey | OQJVEZGTEOLYTB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|