C13H20Cl2S — CID 79447206
3-[3,3-bis(chloromethyl)-5-methylhexyl]thiophene (PubChem CID 79447206) has the molecular formula C13H20Cl2S and a molecular weight of 279.28 g/mol. Its IUPAC name is 3-[3,3-bis(chloromethyl)-5-methylhexyl]thiophene.
| Compound Name | 3-[3,3-bis(chloromethyl)-5-methylhexyl]thiophene |
|---|---|
| PubChem CID | 79447206 |
| Molecular Formula | C13H20Cl2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-[3,3-bis(chloromethyl)-5-methylhexyl]thiophene |
| SMILES | CC(C)CC(CCl)(CCl)CCc1ccsc1 |
| InChI | InChI=1S/C13H20Cl2S/c1-11(2)7-13(9-14,10-15)5-3-12-4-6-16-8-12/h4,6,8,11H,3,5,7,9-10H2,1-2H3 |
| InChIKey | WBKSORUKAKGXLM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|