About pentan-2-yl 4-(trifluoromethyl)benzoate
pentan-2-yl 4-(trifluoromethyl)benzoate (PubChem CID 551102) has the molecular formula C13H15F3O2
and a molecular weight of 260.25 g/mol. Its IUPAC name is pentan-2-yl 4-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | pentan-2-yl 4-(trifluoromethyl)benzoate |
| PubChem CID | 551102 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | pentan-2-yl 4-(trifluoromethyl)benzoate |
| SMILES | CCCC(C)OC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O2/c1-3-4-9(2)18-12(17)10-5-7-11(8-6-10)13(14,15)16/h5-9H,3-4H2,1-2H3 |
| InChIKey | SHJKPTBDBXGWHL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentan-2-yl 4-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl 4-(trifluoromethyl)benzoate?
The IUPAC name of pentan-2-yl 4-(trifluoromethyl)benzoate (CID 551102) is pentan-2-yl 4-(trifluoromethyl)benzoate.
What is the SMILES notation for pentan-2-yl 4-(trifluoromethyl)benzoate?
The canonical SMILES for pentan-2-yl 4-(trifluoromethyl)benzoate is CCCC(C)OC(=O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of pentan-2-yl 4-(trifluoromethyl)benzoate?
The InChIKey is SHJKPTBDBXGWHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3O2/c1-3-4-9(2)18-12(17)10-5-7-11(8-6-10)13(14,15)16/h5-9H,3-4H2,1-2H3.
What are the key properties of pentan-2-yl 4-(trifluoromethyl)benzoate?
pentan-2-yl 4-(trifluoromethyl)benzoate has a molecular weight of 260.25 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl 4-(trifluoromethyl)benzoate is sourced from PubChem (CID 551102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).