C14H14F2N2O — CID 55111900
[2-(3,5-difluorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine (PubChem CID 55111900) has the molecular formula C14H14F2N2O and a molecular weight of 264.27 g/mol. Its IUPAC name is [2-(3,5-difluorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine.
| Compound Name | [2-(3,5-difluorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 55111900 |
| Molecular Formula | C14H14F2N2O |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [2-(3,5-difluorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine |
| SMILES | Cc1cc(C)c(CN)c(Oc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C14H14F2N2O/c1-8-3-9(2)18-14(13(8)7-17)19-12-5-10(15)4-11(16)6-12/h3-6H,7,17H2,1-2H3 |
| InChIKey | XCNBPOVJHSLKHL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |