C12H12N2O2S — CID 55112410
2-(N,3-dimethylanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 55112410) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-(N,3-dimethylanilino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(N,3-dimethylanilino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 55112410 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-(N,3-dimethylanilino)-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1cccc(N(C)c2ncc(C(=O)O)s2)c1 |
| InChI | InChI=1S/C12H12N2O2S/c1-8-4-3-5-9(6-8)14(2)12-13-7-10(17-12)11(15)16/h3-7H,1-2H3,(H,15,16) |
| InChIKey | YSSBCVOOYXXDDF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |