C12H9N3OS — CID 55116246
2-amino-N-(3-ethynylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 55116246) has the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-amino-N-(3-ethynylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(3-ethynylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55116246 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-amino-N-(3-ethynylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)c2csc(N)n2)c1 |
| InChI | InChI=1S/C12H9N3OS/c1-2-8-4-3-5-9(6-8)14-11(16)10-7-17-12(13)15-10/h1,3-7H,(H2,13,15)(H,14,16) |
| InChIKey | USWMTYHOZBTHPK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|