C18H19F6NO4 — CID 551163
ethyl 2,2,3,3,4,4-hexafluoro-5-(3-methyl-2-phenylmorpholin-4-yl)-5-oxopentanoate (PubChem CID 551163) has the molecular formula C18H19F6NO4 and a molecular weight of 427.34 g/mol. Its IUPAC name is ethyl 2,2,3,3,4,4-hexafluoro-5-(3-methyl-2-phenylmorpholin-4-yl)-5-oxopentanoate.
| Compound Name | ethyl 2,2,3,3,4,4-hexafluoro-5-(3-methyl-2-phenylmorpholin-4-yl)-5-oxopentanoate |
|---|---|
| PubChem CID | 551163 |
| Molecular Formula | C18H19F6NO4 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | ethyl 2,2,3,3,4,4-hexafluoro-5-(3-methyl-2-phenylmorpholin-4-yl)-5-oxopentanoate |
| SMILES | CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)N1CCOC(c2ccccc2)C1C |
| InChI | InChI=1S/C18H19F6NO4/c1-3-28-15(27)17(21,22)18(23,24)16(19,20)14(26)25-9-10-29-13(11(25)2)12-7-5-4-6-8-12/h4-8,11,13H,3,9-10H2,1-2H3 |
| InChIKey | YBKSKIKJGCILOY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|