C12H11BrFN3OS — CID 55118101
5-amino-2-bromo-4-fluoro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 55118101) has the molecular formula C12H11BrFN3OS and a molecular weight of 344.21 g/mol. Its IUPAC name is 5-amino-2-bromo-4-fluoro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 5-amino-2-bromo-4-fluoro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55118101 |
| Molecular Formula | C12H11BrFN3OS |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 5-amino-2-bromo-4-fluoro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | Cc1nc(CNC(=O)c2cc(N)c(F)cc2Br)cs1 |
| InChI | InChI=1S/C12H11BrFN3OS/c1-6-17-7(5-19-6)4-16-12(18)8-2-11(15)10(14)3-9(8)13/h2-3,5H,4,15H2,1H3,(H,16,18) |
| InChIKey | GDHBHBNPDBQCKS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|