C16H17FO — CID 55120280
1-(2,4-dimethylphenyl)-1-(2-fluorophenyl)ethanol (PubChem CID 55120280) has the molecular formula C16H17FO and a molecular weight of 244.31 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-1-(2-fluorophenyl)ethanol.
| Compound Name | 1-(2,4-dimethylphenyl)-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 55120280 |
| Molecular Formula | C16H17FO |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-1-(2-fluorophenyl)ethanol |
| SMILES | Cc1ccc(C(C)(O)c2ccccc2F)c(C)c1 |
| InChI | InChI=1S/C16H17FO/c1-11-8-9-13(12(2)10-11)16(3,18)14-6-4-5-7-15(14)17/h4-10,18H,1-3H3 |
| InChIKey | AQDZQGSDFNFFOC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |