C15H17NO2 — CID 55127615
1-[2-(3,4-dimethylphenyl)-2-hydroxyethyl]pyridin-4-one (PubChem CID 55127615) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenyl)-2-hydroxyethyl]pyridin-4-one.
| Compound Name | 1-[2-(3,4-dimethylphenyl)-2-hydroxyethyl]pyridin-4-one |
|---|---|
| PubChem CID | 55127615 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-[2-(3,4-dimethylphenyl)-2-hydroxyethyl]pyridin-4-one |
| SMILES | Cc1ccc(C(O)Cn2ccc(=O)cc2)cc1C |
| InChI | InChI=1S/C15H17NO2/c1-11-3-4-13(9-12(11)2)15(18)10-16-7-5-14(17)6-8-16/h3-9,15,18H,10H2,1-2H3 |
| InChIKey | UDTJITUQQLANGR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |