C13H21N3S — CID 55128126
3-[[butyl(ethyl)amino]methyl]pyridine-2-carbothioamide (PubChem CID 55128126) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 3-[[butyl(ethyl)amino]methyl]pyridine-2-carbothioamide.
| Compound Name | 3-[[butyl(ethyl)amino]methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 55128126 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3-[[butyl(ethyl)amino]methyl]pyridine-2-carbothioamide |
| SMILES | CCCCN(CC)Cc1cccnc1C(N)=S |
| InChI | InChI=1S/C13H21N3S/c1-3-5-9-16(4-2)10-11-7-6-8-15-12(11)13(14)17/h6-8H,3-5,9-10H2,1-2H3,(H2,14,17) |
| InChIKey | NSRPTTCSXJCCIR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|