C11H14F3N3S — CID 62894793
3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyridine-2-carbothioamide (PubChem CID 62894793) has the molecular formula C11H14F3N3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyridine-2-carbothioamide.
| Compound Name | 3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 62894793 |
| Molecular Formula | C11H14F3N3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyridine-2-carbothioamide |
| SMILES | CCN(Cc1cccnc1C(N)=S)CC(F)(F)F |
| InChI | InChI=1S/C11H14F3N3S/c1-2-17(7-11(12,13)14)6-8-4-3-5-16-9(8)10(15)18/h3-5H,2,6-7H2,1H3,(H2,15,18) |
| InChIKey | KJFPRLKOECFYIA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|