C15H17N3O — CID 55128216
3-[(3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide (PubChem CID 55128216) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide.
| Compound Name | 3-[(3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 55128216 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-[(3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncccc1COc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H17N3O/c1-10-6-11(2)8-13(7-10)19-9-12-4-3-5-18-14(12)15(16)17/h3-8H,9H2,1-2H3,(H3,16,17) |
| InChIKey | GNPTYVNENUJWEF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|