About 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide
3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide (PubChem CID 62894239) has the molecular formula C15H16ClN3O
and a molecular weight of 289.77 g/mol. Its IUPAC name is 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide.
Molecular Properties
| Compound Name | 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide |
| PubChem CID | 62894239 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncccc1COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C15H16ClN3O/c1-9-6-12(7-10(2)13(9)16)20-8-11-4-3-5-19-14(11)15(17)18/h3-7H,8H2,1-2H3,(H3,17,18) |
| InChIKey | YUUFBUPJGJAPAH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide?
The IUPAC name of 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide (CID 62894239) is 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide.
What is the SMILES notation for 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide?
The canonical SMILES for 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide is [H]/N=C(\N)c1ncccc1COc1cc(C)c(Cl)c(C)c1.
What is the InChIKey of 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide?
The InChIKey is YUUFBUPJGJAPAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN3O/c1-9-6-12(7-10(2)13(9)16)20-8-11-4-3-5-19-14(11)15(17)18/h3-7H,8H2,1-2H3,(H3,17,18).
What are the key properties of 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide?
3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide has a molecular weight of 289.77 g/mol, XLogP of 3.21, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine-2-carboximidamide is sourced from PubChem (CID 62894239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).