C13H21NO3 — CID 55133858
N-methyl-1-[2-(oxan-4-ylmethoxymethyl)furan-3-yl]methanamine (PubChem CID 55133858) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is N-methyl-1-[2-(oxan-4-ylmethoxymethyl)furan-3-yl]methanamine.
| Compound Name | N-methyl-1-[2-(oxan-4-ylmethoxymethyl)furan-3-yl]methanamine |
|---|---|
| PubChem CID | 55133858 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-methyl-1-[2-(oxan-4-ylmethoxymethyl)furan-3-yl]methanamine |
| SMILES | CNCc1ccoc1COCC1CCOCC1 |
| InChI | InChI=1S/C13H21NO3/c1-14-8-12-4-7-17-13(12)10-16-9-11-2-5-15-6-3-11/h4,7,11,14H,2-3,5-6,8-10H2,1H3 |
| InChIKey | QGWRFIUSZXUHPR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |