C14H23NO2S — CID 80734122
N-methyl-1-[5-methyl-4-(oxan-4-ylmethoxymethyl)thiophen-2-yl]methanamine (PubChem CID 80734122) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is N-methyl-1-[5-methyl-4-(oxan-4-ylmethoxymethyl)thiophen-2-yl]methanamine.
| Compound Name | N-methyl-1-[5-methyl-4-(oxan-4-ylmethoxymethyl)thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 80734122 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-methyl-1-[5-methyl-4-(oxan-4-ylmethoxymethyl)thiophen-2-yl]methanamine |
| SMILES | CNCc1cc(COCC2CCOCC2)c(C)s1 |
| InChI | InChI=1S/C14H23NO2S/c1-11-13(7-14(18-11)8-15-2)10-17-9-12-3-5-16-6-4-12/h7,12,15H,3-6,8-10H2,1-2H3 |
| InChIKey | VHJUZHZGPWZMGB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |