C14H18N2O — CID 55135554
3-[cyclopropyl-(2-hydroxy-2-phenylethyl)amino]propanenitrile (PubChem CID 55135554) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[cyclopropyl-(2-hydroxy-2-phenylethyl)amino]propanenitrile.
| Compound Name | 3-[cyclopropyl-(2-hydroxy-2-phenylethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 55135554 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-[cyclopropyl-(2-hydroxy-2-phenylethyl)amino]propanenitrile |
| SMILES | N#CCCN(CC(O)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C14H18N2O/c15-9-4-10-16(13-7-8-13)11-14(17)12-5-2-1-3-6-12/h1-3,5-6,13-14,17H,4,7-8,10-11H2 |
| InChIKey | PIYGAOHJTUOCLU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |