C12H15BrN4O — CID 55137906
4-bromo-1-ethyl-N-[(2-methylpyrazol-3-yl)methyl]pyrrole-2-carboxamide (PubChem CID 55137906) has the molecular formula C12H15BrN4O and a molecular weight of 311.18 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-[(2-methylpyrazol-3-yl)methyl]pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-[(2-methylpyrazol-3-yl)methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55137906 |
| Molecular Formula | C12H15BrN4O |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-bromo-1-ethyl-N-[(2-methylpyrazol-3-yl)methyl]pyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NCc1ccnn1C |
| InChI | InChI=1S/C12H15BrN4O/c1-3-17-8-9(13)6-11(17)12(18)14-7-10-4-5-15-16(10)2/h4-6,8H,3,7H2,1-2H3,(H,14,18) |
| InChIKey | XCFWSFALRMEAGF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |