C16H28N2O — CID 55139909
1-(3,4-dimethylphenyl)-N'-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 55139909) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N'-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | 1-(3,4-dimethylphenyl)-N'-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 55139909 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N'-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNC(CN(C)CCCOC)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H28N2O/c1-13-7-8-15(11-14(13)2)16(17-3)12-18(4)9-6-10-19-5/h7-8,11,16-17H,6,9-10,12H2,1-5H3 |
| InChIKey | PFATXPBTBVZOLK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|