C14H21F2NO — CID 55143417
4-(2,3-difluorophenoxy)-5,5-dimethylhexan-3-amine (PubChem CID 55143417) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-(2,3-difluorophenoxy)-5,5-dimethylhexan-3-amine.
| Compound Name | 4-(2,3-difluorophenoxy)-5,5-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 55143417 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-(2,3-difluorophenoxy)-5,5-dimethylhexan-3-amine |
| SMILES | CCC(N)C(Oc1cccc(F)c1F)C(C)(C)C |
| InChI | InChI=1S/C14H21F2NO/c1-5-10(17)13(14(2,3)4)18-11-8-6-7-9(15)12(11)16/h6-8,10,13H,5,17H2,1-4H3 |
| InChIKey | VIHKCUKOBQOCLR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |