C14H17BrO2 — CID 55144249
5-[bromo(oxan-3-yl)methyl]-1,3-dihydro-2-benzofuran (PubChem CID 55144249) has the molecular formula C14H17BrO2 and a molecular weight of 297.19 g/mol. Its IUPAC name is 5-[bromo(oxan-3-yl)methyl]-1,3-dihydro-2-benzofuran.
| Compound Name | 5-[bromo(oxan-3-yl)methyl]-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 55144249 |
| Molecular Formula | C14H17BrO2 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 5-[bromo(oxan-3-yl)methyl]-1,3-dihydro-2-benzofuran |
| SMILES | BrC(c1ccc2c(c1)COC2)C1CCCOC1 |
| InChI | InChI=1S/C14H17BrO2/c15-14(12-2-1-5-16-8-12)10-3-4-11-7-17-9-13(11)6-10/h3-4,6,12,14H,1-2,5,7-9H2 |
| InChIKey | BLGLADHTCBJSLB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|