C14H17BrO — CID 63020800
5-[bromo(cyclopentyl)methyl]-1,3-dihydro-2-benzofuran (PubChem CID 63020800) has the molecular formula C14H17BrO and a molecular weight of 281.19 g/mol. Its IUPAC name is 5-[bromo(cyclopentyl)methyl]-1,3-dihydro-2-benzofuran.
| Compound Name | 5-[bromo(cyclopentyl)methyl]-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 63020800 |
| Molecular Formula | C14H17BrO |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 5-[bromo(cyclopentyl)methyl]-1,3-dihydro-2-benzofuran |
| SMILES | BrC(c1ccc2c(c1)COC2)C1CCCC1 |
| InChI | InChI=1S/C14H17BrO/c15-14(10-3-1-2-4-10)11-5-6-12-8-16-9-13(12)7-11/h5-7,10,14H,1-4,8-9H2 |
| InChIKey | HTBMQNATYADJJC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|