About 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one
4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one (PubChem CID 55145830) has the molecular formula C12H15F2N3O
and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one.
Molecular Properties
| Compound Name | 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one |
| PubChem CID | 55145830 |
| Molecular Formula | C12H15F2N3O |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one |
| SMILES | CNCc1cc(F)c(N2CCNC(=O)C2)c(F)c1 |
| InChI | InChI=1S/C12H15F2N3O/c1-15-6-8-4-9(13)12(10(14)5-8)17-3-2-16-11(18)7-17/h4-5,15H,2-3,6-7H2,1H3,(H,16,18) |
| InChIKey | UOJPSYGZLQBXKI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one?
The IUPAC name of 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one (CID 55145830) is 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one.
What is the SMILES notation for 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one?
The canonical SMILES for 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one is CNCc1cc(F)c(N2CCNC(=O)C2)c(F)c1.
What is the InChIKey of 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one?
The InChIKey is UOJPSYGZLQBXKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N3O/c1-15-6-8-4-9(13)12(10(14)5-8)17-3-2-16-11(18)7-17/h4-5,15H,2-3,6-7H2,1H3,(H,16,18).
What are the key properties of 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one?
4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one has a molecular weight of 255.27 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,6-difluoro-4-(methylaminomethyl)phenyl]piperazin-2-one is sourced from PubChem (CID 55145830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).