C12H6ClF5S — CID 55149357
2-[2-chloro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]thiophene (PubChem CID 55149357) has the molecular formula C12H6ClF5S and a molecular weight of 312.69 g/mol. Its IUPAC name is 2-[2-chloro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]thiophene.
| Compound Name | 2-[2-chloro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]thiophene |
|---|---|
| PubChem CID | 55149357 |
| Molecular Formula | C12H6ClF5S |
| Molecular Weight | 312.69 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 2-[2-chloro-2-(2,3,4,5,6-pentafluorophenyl)ethyl]thiophene |
| SMILES | Fc1c(F)c(F)c(C(Cl)Cc2cccs2)c(F)c1F |
| InChI | InChI=1S/C12H6ClF5S/c13-6(4-5-2-1-3-19-5)7-8(14)10(16)12(18)11(17)9(7)15/h1-3,6H,4H2 |
| InChIKey | MFKCZNBAIGKYHP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|