C13H25N5 — CID 55149857
2-[4-(3-imidazol-1-ylpropyl)-1,4-diazepan-1-yl]ethanamine (PubChem CID 55149857) has the molecular formula C13H25N5 and a molecular weight of 251.38 g/mol. Its IUPAC name is 2-[4-(3-imidazol-1-ylpropyl)-1,4-diazepan-1-yl]ethanamine.
| Compound Name | 2-[4-(3-imidazol-1-ylpropyl)-1,4-diazepan-1-yl]ethanamine |
|---|---|
| PubChem CID | 55149857 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 2-[4-(3-imidazol-1-ylpropyl)-1,4-diazepan-1-yl]ethanamine |
| SMILES | NCCN1CCCN(CCCn2ccnc2)CC1 |
| InChI | InChI=1S/C13H25N5/c14-3-9-17-7-1-5-16(11-12-17)6-2-8-18-10-4-15-13-18/h4,10,13H,1-3,5-9,11-12,14H2 |
| InChIKey | GENHOBUUTLXQEM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |