C15H29N5 — CID 63343574
2-[4-(3-imidazol-1-ylpropyl)piperazin-1-yl]pentan-1-amine (PubChem CID 63343574) has the molecular formula C15H29N5 and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-[4-(3-imidazol-1-ylpropyl)piperazin-1-yl]pentan-1-amine.
| Compound Name | 2-[4-(3-imidazol-1-ylpropyl)piperazin-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 63343574 |
| Molecular Formula | C15H29N5 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | 2-[4-(3-imidazol-1-ylpropyl)piperazin-1-yl]pentan-1-amine |
| SMILES | CCCC(CN)N1CCN(CCCn2ccnc2)CC1 |
| InChI | InChI=1S/C15H29N5/c1-2-4-15(13-16)20-11-9-18(10-12-20)6-3-7-19-8-5-17-14-19/h5,8,14-15H,2-4,6-7,9-13,16H2,1H3 |
| InChIKey | OAASCEJFBUBSNU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |