C48H86N4O2 — CID 68661446
1-[1,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl]-4-(2-imidazol-1-ylethyl)piperazine (PubChem CID 68661446) has the molecular formula C48H86N4O2 and a molecular weight of 751.24 g/mol. Its IUPAC name is 1-[1,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl]-4-(2-imidazol-1-ylethyl)piperazine.
| Compound Name | 1-[1,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl]-4-(2-imidazol-1-ylethyl)piperazine |
|---|---|
| PubChem CID | 68661446 |
| Molecular Formula | C48H86N4O2 |
| Molecular Weight | 751.24 g/mol |
| Exact Mass | 750.68 |
| IUPAC Name | 1-[1,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl]-4-(2-imidazol-1-ylethyl)piperazine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(COCCCCCCCC/C=C\C/C=C\CCCCC)N1CCN(CCn2ccnc2)CC1 |
| InChI | InChI=1S/C48H86N4O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-43-53-45-48(52-41-39-50(40-42-52)37-38-51-36-35-49-47-51)46-54-44-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,35-36,47-48H,3-10,15-16,21-34,37-46H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | FHOPTEQMCYEJPR-MAZCIEHSSA-N |
| XLogP | 12.53 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.24 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|