C10H9N5O2S — CID 55151849
1-(3-cyanophenyl)-N-(1H-1,2,4-triazol-5-yl)methanesulfonamide (PubChem CID 55151849) has the molecular formula C10H9N5O2S and a molecular weight of 263.28 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-N-(1H-1,2,4-triazol-5-yl)methanesulfonamide.
| Compound Name | 1-(3-cyanophenyl)-N-(1H-1,2,4-triazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 55151849 |
| Molecular Formula | C10H9N5O2S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-(3-cyanophenyl)-N-(1H-1,2,4-triazol-5-yl)methanesulfonamide |
| SMILES | N#Cc1cccc(CS(=O)(=O)Nc2ncn[nH]2)c1 |
| InChI | InChI=1S/C10H9N5O2S/c11-5-8-2-1-3-9(4-8)6-18(16,17)15-10-12-7-13-14-10/h1-4,7H,6H2,(H2,12,13,14,15) |
| InChIKey | ZUJLAHWSIQGUBR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |