C13H14N4O2S — CID 104620961
1-(3-cyanophenyl)-N-(4-ethyl-1H-pyrazol-5-yl)methanesulfonamide (PubChem CID 104620961) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-N-(4-ethyl-1H-pyrazol-5-yl)methanesulfonamide.
| Compound Name | 1-(3-cyanophenyl)-N-(4-ethyl-1H-pyrazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 104620961 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(3-cyanophenyl)-N-(4-ethyl-1H-pyrazol-5-yl)methanesulfonamide |
| SMILES | CCc1cn[nH]c1NS(=O)(=O)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H14N4O2S/c1-2-12-8-15-16-13(12)17-20(18,19)9-11-5-3-4-10(6-11)7-14/h3-6,8H,2,9H2,1H3,(H2,15,16,17) |
| InChIKey | IYVGJTOLUIJIPQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |