C12H9N5O2S — CID 79503770
1-(4-cyanophenyl)-N-(4-cyano-1H-pyrazol-5-yl)methanesulfonamide (PubChem CID 79503770) has the molecular formula C12H9N5O2S and a molecular weight of 287.30 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-N-(4-cyano-1H-pyrazol-5-yl)methanesulfonamide.
| Compound Name | 1-(4-cyanophenyl)-N-(4-cyano-1H-pyrazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 79503770 |
| Molecular Formula | C12H9N5O2S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-(4-cyanophenyl)-N-(4-cyano-1H-pyrazol-5-yl)methanesulfonamide |
| SMILES | N#Cc1ccc(CS(=O)(=O)Nc2[nH]ncc2C#N)cc1 |
| InChI | InChI=1S/C12H9N5O2S/c13-5-9-1-3-10(4-2-9)8-20(18,19)17-12-11(6-14)7-15-16-12/h1-4,7H,8H2,(H2,15,16,17) |
| InChIKey | HHQCYVOEIPCYQV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |